C43H49ClN4O5 — CID 70145148
[3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-(2-piperidin-1-ylethyl)indol-2-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 70145148) has the molecular formula C43H49ClN4O5 and a molecular weight of 737.34 g/mol. Its IUPAC name is [3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-(2-piperidin-1-ylethyl)indol-2-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-(2-piperidin-1-ylethyl)indol-2-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 70145148 |
| Molecular Formula | C43H49ClN4O5 |
| Molecular Weight | 737.34 g/mol |
| Exact Mass | 736.34 |
| IUPAC Name | [3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-(2-piperidin-1-ylethyl)indol-2-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | COCOc1ccc(C(c2ccc(OCOC)cc2)c2c(C(=O)N3CCN(c4ccccc4Cl)CC3)n(CCN3CCCCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H49ClN4O5/c1-50-30-52-34-18-14-32(15-19-34)40(33-16-20-35(21-17-33)53-31-51-2)41-36-10-4-6-12-38(36)48(29-24-45-22-8-3-9-23-45)42(41)43(49)47-27-25-46(26-28-47)39-13-7-5-11-37(39)44/h4-7,10-21,40H,3,8-9,22-31H2,1-2H3 |
| InChIKey | MXGAGUFKGLXJDC-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 68.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.34 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|