C32H35ClN2O3 — CID 22440036
ethyl 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-2-ylethyl)indole-2-carboxylate (PubChem CID 22440036) has the molecular formula C32H35ClN2O3 and a molecular weight of 531.10 g/mol. Its IUPAC name is ethyl 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-2-ylethyl)indole-2-carboxylate.
| Compound Name | ethyl 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-2-ylethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 22440036 |
| Molecular Formula | C32H35ClN2O3 |
| Molecular Weight | 531.10 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | ethyl 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-2-ylethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C(c2ccccc2)c2ccc(OCCCl)cc2)c2ccccc2n1CCC1CCCN1 |
| InChI | InChI=1S/C32H35ClN2O3/c1-2-37-32(36)31-30(27-12-6-7-13-28(27)35(31)21-18-25-11-8-20-34-25)29(23-9-4-3-5-10-23)24-14-16-26(17-15-24)38-22-19-33/h3-7,9-10,12-17,25,29,34H,2,8,11,18-22H2,1H3 |
| InChIKey | GUJWFBNPJHCDKG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.10 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|