C38H50N4O2 — CID 67596039
N-cyclooctyl-3-[[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethyl]-1-[2-(dimethylamino)ethyl]indole-2-carboxamide (PubChem CID 67596039) has the molecular formula C38H50N4O2 and a molecular weight of 594.84 g/mol. Its IUPAC name is N-cyclooctyl-3-[[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethyl]-1-[2-(dimethylamino)ethyl]indole-2-carboxamide.
| Compound Name | N-cyclooctyl-3-[[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethyl]-1-[2-(dimethylamino)ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 67596039 |
| Molecular Formula | C38H50N4O2 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | N-cyclooctyl-3-[[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethyl]-1-[2-(dimethylamino)ethyl]indole-2-carboxamide |
| SMILES | CN(C)CCOc1ccc(C(c2ccccc2)c2c(C(=O)NC3CCCCCCC3)n(CCN(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H50N4O2/c1-40(2)25-26-42-34-20-14-13-19-33(34)36(37(42)38(43)39-31-17-11-6-5-7-12-18-31)35(29-15-9-8-10-16-29)30-21-23-32(24-22-30)44-28-27-41(3)4/h8-10,13-16,19-24,31,35H,5-7,11-12,17-18,25-28H2,1-4H3,(H,39,43) |
| InChIKey | WDJSXLLVLRCCNC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|