C37H42N4O5 — CID 67595046
3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-[2-(dimethylamino)ethyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide (PubChem CID 67595046) has the molecular formula C37H42N4O5 and a molecular weight of 622.77 g/mol. Its IUPAC name is 3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-[2-(dimethylamino)ethyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide.
| Compound Name | 3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-[2-(dimethylamino)ethyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 67595046 |
| Molecular Formula | C37H42N4O5 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | 3-[bis[4-(methoxymethoxy)phenyl]methyl]-1-[2-(dimethylamino)ethyl]-N-(2-pyridin-4-ylethyl)indole-2-carboxamide |
| SMILES | COCOc1ccc(C(c2ccc(OCOC)cc2)c2c(C(=O)NCCc3ccncc3)n(CCN(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H42N4O5/c1-40(2)23-24-41-33-8-6-5-7-32(33)35(36(41)37(42)39-22-19-27-17-20-38-21-18-27)34(28-9-13-30(14-10-28)45-25-43-3)29-11-15-31(16-12-29)46-26-44-4/h5-18,20-21,34H,19,22-26H2,1-4H3,(H,39,42) |
| InChIKey | IYLMYVKVOPIXKQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|