C33H41N3O7S — CID 67691929
2-[3-[bis[4-(methoxymethoxy)phenyl]methyl]-2-morpholin-4-ylsulfonylindol-1-yl]-N,N-dimethylethanamine (PubChem CID 67691929) has the molecular formula C33H41N3O7S and a molecular weight of 623.77 g/mol. Its IUPAC name is 2-[3-[bis[4-(methoxymethoxy)phenyl]methyl]-2-morpholin-4-ylsulfonylindol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[3-[bis[4-(methoxymethoxy)phenyl]methyl]-2-morpholin-4-ylsulfonylindol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 67691929 |
| Molecular Formula | C33H41N3O7S |
| Molecular Weight | 623.77 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | 2-[3-[bis[4-(methoxymethoxy)phenyl]methyl]-2-morpholin-4-ylsulfonylindol-1-yl]-N,N-dimethylethanamine |
| SMILES | COCOc1ccc(C(c2ccc(OCOC)cc2)c2c(S(=O)(=O)N3CCOCC3)n(CCN(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H41N3O7S/c1-34(2)17-18-36-30-8-6-5-7-29(30)32(33(36)44(37,38)35-19-21-41-22-20-35)31(25-9-13-27(14-10-25)42-23-39-3)26-11-15-28(16-12-26)43-24-40-4/h5-16,31H,17-24H2,1-4H3 |
| InChIKey | XBMIWFYOYFCOHP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 91.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|