C31H30ClN3O3 — CID 18950560
[2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 18950560) has the molecular formula C31H30ClN3O3 and a molecular weight of 528.05 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 18950560 |
| Molecular Formula | C31H30ClN3O3 |
| Molecular Weight | 528.05 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)c2cc(C(=O)N3CCN(c4ccccc4Cl)CC3)ccn2)cc1 |
| InChI | InChI=1S/C31H30ClN3O3/c1-37-25-11-7-22(8-12-25)30(23-9-13-26(38-2)14-10-23)28-21-24(15-16-33-28)31(36)35-19-17-34(18-20-35)29-6-4-3-5-27(29)32/h3-16,21,30H,17-20H2,1-2H3 |
| InChIKey | XSJISUOKSFVIPZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.05 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |