C32H33N3O4 — CID 18950554
[2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 18950554) has the molecular formula C32H33N3O4 and a molecular weight of 523.63 g/mol. Its IUPAC name is [2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 18950554 |
| Molecular Formula | C32H33N3O4 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | [2-[bis(4-methoxyphenyl)methyl]-4-pyridinyl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)c2cc(C(=O)N3CCN(c4ccccc4OC)CC3)ccn2)cc1 |
| InChI | InChI=1S/C32H33N3O4/c1-37-26-12-8-23(9-13-26)31(24-10-14-27(38-2)15-11-24)28-22-25(16-17-33-28)32(36)35-20-18-34(19-21-35)29-6-4-5-7-30(29)39-3/h4-17,22,31H,18-21H2,1-3H3 |
| InChIKey | UNURUFBLODLFNH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |