C35H40N4O3 — CID 67594205
N-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[phenyl-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1H-indole-2-carboxamide (PubChem CID 67594205) has the molecular formula C35H40N4O3 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[phenyl-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[phenyl-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67594205 |
| Molecular Formula | C35H40N4O3 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[phenyl-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1[nH]c2ccccc2c1C(c1ccccc1)c1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C35H40N4O3/c40-31-14-8-22-39(31)23-9-19-36-35(41)34-33(29-12-4-5-13-30(29)37-34)32(26-10-2-1-3-11-26)27-15-17-28(18-16-27)42-25-24-38-20-6-7-21-38/h1-5,10-13,15-18,32,37H,6-9,14,19-25H2,(H,36,41) |
| InChIKey | KFNPDOLYCHDJSP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|