C31H34N4O2 — CID 67594143
1-(2-aminoethyl)-3-benzhydryl-N-[3-(2-oxopyrrolidin-1-yl)propyl]indole-2-carboxamide (PubChem CID 67594143) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-benzhydryl-N-[3-(2-oxopyrrolidin-1-yl)propyl]indole-2-carboxamide.
| Compound Name | 1-(2-aminoethyl)-3-benzhydryl-N-[3-(2-oxopyrrolidin-1-yl)propyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 67594143 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 1-(2-aminoethyl)-3-benzhydryl-N-[3-(2-oxopyrrolidin-1-yl)propyl]indole-2-carboxamide |
| SMILES | NCCn1c(C(=O)NCCCN2CCCC2=O)c(C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H34N4O2/c32-18-22-35-26-16-8-7-15-25(26)29(28(23-11-3-1-4-12-23)24-13-5-2-6-14-24)30(35)31(37)33-19-10-21-34-20-9-17-27(34)36/h1-8,11-16,28H,9-10,17-22,32H2,(H,33,37) |
| InChIKey | BMSKMNSLQJLSIO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|