C31H33N3O2 — CID 132543975
N-cyclohexyl-2-(N-[2-(1-methylindol-3-yl)acetyl]anilino)-2-phenylacetamide (PubChem CID 132543975) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-cyclohexyl-2-(N-[2-(1-methylindol-3-yl)acetyl]anilino)-2-phenylacetamide.
| Compound Name | N-cyclohexyl-2-(N-[2-(1-methylindol-3-yl)acetyl]anilino)-2-phenylacetamide |
|---|---|
| PubChem CID | 132543975 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-cyclohexyl-2-(N-[2-(1-methylindol-3-yl)acetyl]anilino)-2-phenylacetamide |
| SMILES | Cn1cc(CC(=O)N(c2ccccc2)C(C(=O)NC2CCCCC2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H33N3O2/c1-33-22-24(27-19-11-12-20-28(27)33)21-29(35)34(26-17-9-4-10-18-26)30(23-13-5-2-6-14-23)31(36)32-25-15-7-3-8-16-25/h2,4-6,9-14,17-20,22,25,30H,3,7-8,15-16,21H2,1H3,(H,32,36) |
| InChIKey | XCUFWWOMFJWLLK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |