C36H38N4O3 — CID 10531205
3-benzhydryl-1-[3-(dimethylamino)propyl]-5-nitro-N-(4-propylphenyl)indole-2-carboxamide (PubChem CID 10531205) has the molecular formula C36H38N4O3 and a molecular weight of 574.73 g/mol. Its IUPAC name is 3-benzhydryl-1-[3-(dimethylamino)propyl]-5-nitro-N-(4-propylphenyl)indole-2-carboxamide.
| Compound Name | 3-benzhydryl-1-[3-(dimethylamino)propyl]-5-nitro-N-(4-propylphenyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 10531205 |
| Molecular Formula | C36H38N4O3 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 3-benzhydryl-1-[3-(dimethylamino)propyl]-5-nitro-N-(4-propylphenyl)indole-2-carboxamide |
| SMILES | CCCc1ccc(NC(=O)c2c(C(c3ccccc3)c3ccccc3)c3cc([N+](=O)[O-])ccc3n2CCCN(C)C)cc1 |
| InChI | InChI=1S/C36H38N4O3/c1-4-12-26-17-19-29(20-18-26)37-36(41)35-34(33(27-13-7-5-8-14-27)28-15-9-6-10-16-28)31-25-30(40(42)43)21-22-32(31)39(35)24-11-23-38(2)3/h5-10,13-22,25,33H,4,11-12,23-24H2,1-3H3,(H,37,41) |
| InChIKey | UCDOSCRUHOZSJG-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|