C30H35N3O — CID 10671386
3-benzyl-1-[3-(dimethylamino)propyl]-N-(4-propylphenyl)indole-2-carboxamide (PubChem CID 10671386) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-benzyl-1-[3-(dimethylamino)propyl]-N-(4-propylphenyl)indole-2-carboxamide.
| Compound Name | 3-benzyl-1-[3-(dimethylamino)propyl]-N-(4-propylphenyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 10671386 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 3-benzyl-1-[3-(dimethylamino)propyl]-N-(4-propylphenyl)indole-2-carboxamide |
| SMILES | CCCc1ccc(NC(=O)c2c(Cc3ccccc3)c3ccccc3n2CCCN(C)C)cc1 |
| InChI | InChI=1S/C30H35N3O/c1-4-11-23-16-18-25(19-17-23)31-30(34)29-27(22-24-12-6-5-7-13-24)26-14-8-9-15-28(26)33(29)21-10-20-32(2)3/h5-9,12-19H,4,10-11,20-22H2,1-3H3,(H,31,34) |
| InChIKey | BUBHGTVJJUBTCH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|