C26H32N2O — CID 157329260
(E)-1-[1-[3-(dimethylamino)propyl]-2-methylindol-3-yl]-6-phenylhex-1-en-3-one (PubChem CID 157329260) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (E)-1-[1-[3-(dimethylamino)propyl]-2-methylindol-3-yl]-6-phenylhex-1-en-3-one.
| Compound Name | (E)-1-[1-[3-(dimethylamino)propyl]-2-methylindol-3-yl]-6-phenylhex-1-en-3-one |
|---|---|
| PubChem CID | 157329260 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (E)-1-[1-[3-(dimethylamino)propyl]-2-methylindol-3-yl]-6-phenylhex-1-en-3-one |
| SMILES | Cc1c(/C=C/C(=O)CCCc2ccccc2)c2ccccc2n1CCCN(C)C |
| InChI | InChI=1S/C26H32N2O/c1-21-24(18-17-23(29)14-9-13-22-11-5-4-6-12-22)25-15-7-8-16-26(25)28(21)20-10-19-27(2)3/h4-8,11-12,15-18H,9-10,13-14,19-20H2,1-3H3/b18-17+ |
| InChIKey | UKHKYFFXOOZVQJ-ISLYRVAYSA-N |
| XLogP | 5.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|