C37H46N4O2 — CID 67594337
3-[bis(4-methylphenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1-(1-pyrrolidin-2-ylethyl)indole-2-carboxamide (PubChem CID 67594337) has the molecular formula C37H46N4O2 and a molecular weight of 578.80 g/mol. Its IUPAC name is 3-[bis(4-methylphenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1-(1-pyrrolidin-2-ylethyl)indole-2-carboxamide.
| Compound Name | 3-[bis(4-methylphenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1-(1-pyrrolidin-2-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 67594337 |
| Molecular Formula | C37H46N4O2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 3-[bis(4-methylphenyl)methyl]-N-(3-morpholin-4-ylpropyl)-1-(1-pyrrolidin-2-ylethyl)indole-2-carboxamide |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)c2c(C(=O)NCCCN3CCOCC3)n(C(C)C3CCCN3)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H46N4O2/c1-26-11-15-29(16-12-26)34(30-17-13-27(2)14-18-30)35-31-8-4-5-10-33(31)41(28(3)32-9-6-19-38-32)36(35)37(42)39-20-7-21-40-22-24-43-25-23-40/h4-5,8,10-18,28,32,34,38H,6-7,9,19-25H2,1-3H3,(H,39,42) |
| InChIKey | ZRQREXBWJHMKIH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|