C25H30N4O3 — CID 103599343
3-(9-ethylcarbazol-3-yl)-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 103599343) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-(9-ethylcarbazol-3-yl)-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-(9-ethylcarbazol-3-yl)-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 103599343 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-(9-ethylcarbazol-3-yl)-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CCn1c2ccccc2c2cc(C=CC(=O)NCC(=O)NCCN3CCOCC3)ccc21 |
| InChI | InChI=1S/C25H30N4O3/c1-2-29-22-6-4-3-5-20(22)21-17-19(7-9-23(21)29)8-10-24(30)27-18-25(31)26-11-12-28-13-15-32-16-14-28/h3-10,17H,2,11-16,18H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | JZKMOBPMKMDABS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|