C22H24N2O2 — CID 86896908
(E)-3-(9-ethylcarbazol-3-yl)-N-methyl-N-(oxolan-3-yl)prop-2-enamide (PubChem CID 86896908) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (E)-3-(9-ethylcarbazol-3-yl)-N-methyl-N-(oxolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(9-ethylcarbazol-3-yl)-N-methyl-N-(oxolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 86896908 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (E)-3-(9-ethylcarbazol-3-yl)-N-methyl-N-(oxolan-3-yl)prop-2-enamide |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C(=O)N(C)C3CCOC3)ccc21 |
| InChI | InChI=1S/C22H24N2O2/c1-3-24-20-7-5-4-6-18(20)19-14-16(8-10-21(19)24)9-11-22(25)23(2)17-12-13-26-15-17/h4-11,14,17H,3,12-13,15H2,1-2H3/b11-9+ |
| InChIKey | IAFRTNSRSXQBJW-PKNBQFBNSA-N |
| XLogP | 4.07 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|