C23H26N2O3S — CID 51110283
(E)-N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(9-ethylcarbazol-3-yl)prop-2-enamide (PubChem CID 51110283) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(9-ethylcarbazol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(9-ethylcarbazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51110283 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(9-ethylcarbazol-3-yl)prop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1ccc2c(c1)c1ccccc1n2CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H26N2O3S/c1-3-24(18-13-14-29(27,28)16-18)23(26)12-10-17-9-11-22-20(15-17)19-7-5-6-8-21(19)25(22)4-2/h5-12,15,18H,3-4,13-14,16H2,1-2H3/b12-10+ |
| InChIKey | OVGDLIITNMPKHV-ZRDIBKRKSA-N |
| XLogP | 3.86 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|