C17H22N2O3S — CID 110762572
N-(1,1-dioxothiolan-3-yl)-N-ethyl-1,2-dimethylindole-3-carboxamide (PubChem CID 110762572) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-1,2-dimethylindole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-1,2-dimethylindole-3-carboxamide |
|---|---|
| PubChem CID | 110762572 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-1,2-dimethylindole-3-carboxamide |
| SMILES | CCN(C(=O)c1c(C)n(C)c2ccccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22N2O3S/c1-4-19(13-9-10-23(21,22)11-13)17(20)16-12(2)18(3)15-8-6-5-7-14(15)16/h5-8,13H,4,9-11H2,1-3H3 |
| InChIKey | UVUXEMXMCREJOP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |