C16H18N2O4S — CID 110694489
N-(1,1-dioxothiolan-3-yl)-N,1-dimethyl-2-oxoquinoline-4-carboxamide (PubChem CID 110694489) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,1-dimethyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,1-dimethyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 110694489 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,1-dimethyl-2-oxoquinoline-4-carboxamide |
| SMILES | CN(C(=O)c1cc(=O)n(C)c2ccccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O4S/c1-17(11-7-8-23(21,22)10-11)16(20)13-9-15(19)18(2)14-6-4-3-5-12(13)14/h3-6,9,11H,7-8,10H2,1-2H3 |
| InChIKey | LJRPSRCCKBWTDI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |