C18H22N4O4S — CID 109067011
1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-3-N-prop-2-enylimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109067011) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-3-N-prop-2-enylimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-3-N-prop-2-enylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109067011 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-N-(1,1-dioxothiolan-3-yl)-1-N-ethyl-3-N-prop-2-enylimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)c1nc(C(=O)N(CC)C2CCS(=O)(=O)C2)c2ccccn12 |
| InChI | InChI=1S/C18H22N4O4S/c1-3-9-19-17(23)16-20-15(14-7-5-6-10-22(14)16)18(24)21(4-2)13-8-11-27(25,26)12-13/h3,5-7,10,13H,1,4,8-9,11-12H2,2H3,(H,19,23) |
| InChIKey | ASENDHFVICSOTE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|