C14H20N4O3S — CID 109247709
2-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 109247709) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109247709 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-ethylamino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(N(CC)C2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C14H20N4O3S/c1-3-6-15-13(19)11-8-16-14(17-9-11)18(4-2)12-5-7-22(20,21)10-12/h3,8-9,12H,1,4-7,10H2,2H3,(H,15,19) |
| InChIKey | RVWWVTWRJVALJY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|