C26H32FN3O2 — CID 93119934
(3S)-3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 93119934) has the molecular formula C26H32FN3O2 and a molecular weight of 437.56 g/mol. Its IUPAC name is (3S)-3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | (3S)-3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 93119934 |
| Molecular Formula | C26H32FN3O2 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (3S)-3-(1-ethylindol-3-yl)-3-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | CCn1cc([C@@H](CC(=O)NCCCN2CCOCC2)c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H32FN3O2/c1-2-30-19-24(22-6-3-4-7-25(22)30)23(20-8-10-21(27)11-9-20)18-26(31)28-12-5-13-29-14-16-32-17-15-29/h3-4,6-11,19,23H,2,5,12-18H2,1H3,(H,28,31)/t23-/m0/s1 |
| InChIKey | IFOGRCRLPAAIFU-QHCPKHFHSA-N |
| XLogP | 4.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|