C16H13N2O2+ — CID 12014866
6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one (PubChem CID 12014866) has the molecular formula C16H13N2O2+ and a molecular weight of 265.29 g/mol. Its IUPAC name is 6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one.
| Compound Name | 6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 12014866 |
| Molecular Formula | C16H13N2O2+ |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6-hydroxy-1,3-diphenylpyrimidin-1-ium-4-one |
| SMILES | O=c1cc(O)[n+](-c2ccccc2)cn1-c1ccccc1 |
| InChI | InChI=1S/C16H12N2O2/c19-15-11-16(20)18(14-9-5-2-6-10-14)12-17(15)13-7-3-1-4-8-13/h1-12H/p+1 |
| InChIKey | SDEBIGPDWYBOMZ-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|