C30H28N4O5 — CID 12018749
3-methylbutyl 1-[7-(butanoylamino)-5,8-dioxoquinolin-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 12018749) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 3-methylbutyl 1-[7-(butanoylamino)-5,8-dioxoquinolin-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 3-methylbutyl 1-[7-(butanoylamino)-5,8-dioxoquinolin-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 12018749 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 3-methylbutyl 1-[7-(butanoylamino)-5,8-dioxoquinolin-2-yl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCCC(=O)NC1=CC(=O)c2ccc(-c3nc(C(=O)OCCC(C)C)cc4c3[nH]c3ccccc34)nc2C1=O |
| InChI | InChI=1S/C30H28N4O5/c1-4-7-25(36)31-22-15-24(35)18-10-11-21(33-27(18)29(22)37)28-26-19(17-8-5-6-9-20(17)32-26)14-23(34-28)30(38)39-13-12-16(2)3/h5-6,8-11,14-16,32H,4,7,12-13H2,1-3H3,(H,31,36) |
| InChIKey | DLQBEBBXOMNHKA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|