About methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate
methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 10093081) has the molecular formula C23H16N4O4
and a molecular weight of 412.41 g/mol. Its IUPAC name is methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 10093081 |
| Molecular Formula | C23H16N4O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc3c(n2)C(=O)C(N)=CC3=O)c2[nH]c3ccccc3c2c1C |
| InChI | InChI=1S/C23H16N4O4/c1-10-17-11-5-3-4-6-14(11)25-21(17)20(27-18(10)23(30)31-2)15-8-7-12-16(28)9-13(24)22(29)19(12)26-15/h3-9,25H,24H2,1-2H3 |
| InChIKey | LLOJCCZCKAVPOL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (CID 10093081) is methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate is COC(=O)c1nc(-c2ccc3c(n2)C(=O)C(N)=CC3=O)c2[nH]c3ccccc3c2c1C.
What is the InChIKey of methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is LLOJCCZCKAVPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O4/c1-10-17-11-5-3-4-6-14(11)25-21(17)20(27-18(10)23(30)31-2)15-8-7-12-16(28)9-13(24)22(29)19(12)26-15/h3-9,25H,24H2,1-2H3.
What are the key properties of methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate?
methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 412.41 g/mol, XLogP of 3.09, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(7-amino-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 10093081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).