C28H25N5O5 — CID 12018752
2-(dimethylamino)ethyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 12018752) has the molecular formula C28H25N5O5 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 12018752 |
| Molecular Formula | C28H25N5O5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 2-(dimethylamino)ethyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(=O)NC1=CC(=O)c2ccc(-c3nc(C(=O)OCCN(C)C)c(C)c4c3[nH]c3ccccc34)nc2C1=O |
| InChI | InChI=1S/C28H25N5O5/c1-14-22-16-7-5-6-8-18(16)30-26(22)25(32-23(14)28(37)38-12-11-33(3)4)19-10-9-17-21(35)13-20(29-15(2)34)27(36)24(17)31-19/h5-10,13,30H,11-12H2,1-4H3,(H,29,34) |
| InChIKey | OIAKWSKHWQVYIN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|