C17H14N4O6S — CID 12020031
5-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]phenyl]-1,2-oxazole-4-carboxamide (PubChem CID 12020031) has the molecular formula C17H14N4O6S and a molecular weight of 402.39 g/mol. Its IUPAC name is 5-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]phenyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]phenyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 12020031 |
| Molecular Formula | C17H14N4O6S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 5-methyl-N-[2-[(4-nitrophenyl)sulfonylamino]phenyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)Nc1ccccc1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14N4O6S/c1-11-14(10-18-27-11)17(22)19-15-4-2-3-5-16(15)20-28(25,26)13-8-6-12(7-9-13)21(23)24/h2-10,20H,1H3,(H,19,22) |
| InChIKey | AWSQOOCYQCHIPE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 144.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|