C32H35N5O — CID 12020214
4-[4-(4-benzhydrylpiperidin-1-yl)butyl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 12020214) has the molecular formula C32H35N5O and a molecular weight of 505.67 g/mol. Its IUPAC name is 4-[4-(4-benzhydrylpiperidin-1-yl)butyl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-[4-(4-benzhydrylpiperidin-1-yl)butyl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 12020214 |
| Molecular Formula | C32H35N5O |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 4-[4-(4-benzhydrylpiperidin-1-yl)butyl]-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cc1nnc2n(CCCCN3CCC(C(c4ccccc4)c4ccccc4)CC3)c(=O)c3ccccc3n12 |
| InChI | InChI=1S/C32H35N5O/c1-24-33-34-32-36(31(38)28-16-8-9-17-29(28)37(24)32)21-11-10-20-35-22-18-27(19-23-35)30(25-12-4-2-5-13-25)26-14-6-3-7-15-26/h2-9,12-17,27,30H,10-11,18-23H2,1H3 |
| InChIKey | MDNLFFLJLUTKQY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|