C17H26N6OS — CID 12023099
2-ethylsulfanyl-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine (PubChem CID 12023099) has the molecular formula C17H26N6OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine.
| Compound Name | 2-ethylsulfanyl-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine |
|---|---|
| PubChem CID | 12023099 |
| Molecular Formula | C17H26N6OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-ethylsulfanyl-N-(2-morpholin-4-ylethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine |
| SMILES | CCSc1nc2nc3c(c(NCCN4CCOCC4)n2n1)CCCC3 |
| InChI | InChI=1S/C17H26N6OS/c1-2-25-17-20-16-19-14-6-4-3-5-13(14)15(23(16)21-17)18-7-8-22-9-11-24-12-10-22/h18H,2-12H2,1H3 |
| InChIKey | UWYLXQXYBRYRFL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |