C12H13NO3 — CID 12023487
(2S,6S)-2-methyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran (PubChem CID 12023487) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2S,6S)-2-methyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6S)-2-methyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 12023487 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S,6S)-2-methyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyran |
| SMILES | C[C@H]1CC=C[C@@H](c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C12H13NO3/c1-9-3-2-4-12(16-9)10-5-7-11(8-6-10)13(14)15/h2,4-9,12H,3H2,1H3/t9-,12-/m0/s1 |
| InChIKey | HVQGLKMCXQRPIT-CABZTGNLSA-N |
| XLogP | 3.00 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|