C7H12Si — CID 12024669
cyclopenta-1,3-dien-1-yl(dimethyl)silane (PubChem CID 12024669) has the molecular formula C7H12Si and a molecular weight of 124.26 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl(dimethyl)silane.
| Compound Name | cyclopenta-1,3-dien-1-yl(dimethyl)silane |
|---|---|
| PubChem CID | 12024669 |
| Molecular Formula | C7H12Si |
| Molecular Weight | 124.26 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl(dimethyl)silane |
| SMILES | C[SiH](C)C1=CC=CC1 |
| InChI | InChI=1S/C7H12Si/c1-8(2)7-5-3-4-6-7/h3-5,8H,6H2,1-2H3 |
| InChIKey | GJRPEZCBSXLLJN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|