C15H26O2Si2 — CID 12027339
6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylhexa-1,4-diyn-3-one (PubChem CID 12027339) has the molecular formula C15H26O2Si2 and a molecular weight of 294.54 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylhexa-1,4-diyn-3-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylhexa-1,4-diyn-3-one |
|---|---|
| PubChem CID | 12027339 |
| Molecular Formula | C15H26O2Si2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylhexa-1,4-diyn-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H26O2Si2/c1-15(2,3)19(7,8)17-12-9-10-14(16)11-13-18(4,5)6/h12H2,1-8H3 |
| InChIKey | UFAHCBCGQMBPDV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|