C19H38O3Si2 — CID 139263617
(5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-yn-2-one (PubChem CID 139263617) has the molecular formula C19H38O3Si2 and a molecular weight of 370.68 g/mol. Its IUPAC name is (5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-yn-2-one.
| Compound Name | (5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-yn-2-one |
|---|---|
| PubChem CID | 139263617 |
| Molecular Formula | C19H38O3Si2 |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (5R)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-3-yn-2-one |
| SMILES | CC[C@H](C#CC(=O)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O3Si2/c1-12-17(22-24(10,11)19(5,6)7)14-13-16(20)15-21-23(8,9)18(2,3)4/h17H,12,15H2,1-11H3/t17-/m1/s1 |
| InChIKey | IVRVHRDJEWORIH-QGZVFWFLSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|