C26H50O3Si3 — CID 11990076
5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylundeca-1,7-diyn-6-one (PubChem CID 11990076) has the molecular formula C26H50O3Si3 and a molecular weight of 494.94 g/mol. Its IUPAC name is 5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylundeca-1,7-diyn-6-one.
| Compound Name | 5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylundeca-1,7-diyn-6-one |
|---|---|
| PubChem CID | 11990076 |
| Molecular Formula | C26H50O3Si3 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylundeca-1,7-diyn-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC#CC(=O)C(CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O3Si3/c1-25(2,3)31(10,11)28-21-17-14-15-19-23(27)24(20-16-18-22-30(7,8)9)29-32(12,13)26(4,5)6/h24H,14,16-17,20-21H2,1-13H3 |
| InChIKey | UEQFDUXJEATZKB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|