C27H54O3Si2 — CID 46894186
(8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydodec-6-yn-5-one (PubChem CID 46894186) has the molecular formula C27H54O3Si2 and a molecular weight of 482.90 g/mol. Its IUPAC name is (8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydodec-6-yn-5-one.
| Compound Name | (8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydodec-6-yn-5-one |
|---|---|
| PubChem CID | 46894186 |
| Molecular Formula | C27H54O3Si2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | (8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-tri(propan-2-yl)silyloxydodec-6-yn-5-one |
| SMILES | CCCC[C@@H](C#CC(=O)CCCCO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H54O3Si2/c1-13-14-18-26(30-32(22(2)3,23(4)5)24(6)7)20-19-25(28)17-15-16-21-29-31(11,12)27(8,9)10/h22-24,26H,13-18,21H2,1-12H3/t26-/m0/s1 |
| InChIKey | OURUDJICECZSBH-SANMLTNESA-N |
| XLogP | 8.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|