C21H46O3Si2 — CID 11373045
(8S)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]nonan-5-one (PubChem CID 11373045) has the molecular formula C21H46O3Si2 and a molecular weight of 402.77 g/mol. Its IUPAC name is (8S)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]nonan-5-one.
| Compound Name | (8S)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]nonan-5-one |
|---|---|
| PubChem CID | 11373045 |
| Molecular Formula | C21H46O3Si2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (8S)-1,8-bis[[tert-butyl(dimethyl)silyl]oxy]nonan-5-one |
| SMILES | C[C@@H](CCC(=O)CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O3Si2/c1-18(24-26(10,11)21(5,6)7)15-16-19(22)14-12-13-17-23-25(8,9)20(2,3)4/h18H,12-17H2,1-11H3/t18-/m0/s1 |
| InChIKey | YOLPHDJMPFPTGB-SFHVURJKSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|