C16H32O3Si — CID 10881140
7-tri(propan-2-yl)silyloxyheptane-3,4-dione (PubChem CID 10881140) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is 7-tri(propan-2-yl)silyloxyheptane-3,4-dione.
| Compound Name | 7-tri(propan-2-yl)silyloxyheptane-3,4-dione |
|---|---|
| PubChem CID | 10881140 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 7-tri(propan-2-yl)silyloxyheptane-3,4-dione |
| SMILES | CCC(=O)C(=O)CCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-8-15(17)16(18)10-9-11-19-20(12(2)3,13(4)5)14(6)7/h12-14H,8-11H2,1-7H3 |
| InChIKey | GYWWJNFUFMQNTH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|