C26H54O4Si2 — CID 15500761
1,8-bis[tri(propan-2-yl)silyloxy]octane-4,5-dione (PubChem CID 15500761) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is 1,8-bis[tri(propan-2-yl)silyloxy]octane-4,5-dione.
| Compound Name | 1,8-bis[tri(propan-2-yl)silyloxy]octane-4,5-dione |
|---|---|
| PubChem CID | 15500761 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | 1,8-bis[tri(propan-2-yl)silyloxy]octane-4,5-dione |
| SMILES | CC(C)[Si](OCCCC(=O)C(=O)CCCO[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H54O4Si2/c1-19(2)31(20(3)4,21(5)6)29-17-13-15-25(27)26(28)16-14-18-30-32(22(7)8,23(9)10)24(11)12/h19-24H,13-18H2,1-12H3 |
| InChIKey | SYTPDVICPYMFJP-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|