C25H22N2O5 — CID 12031457
[(1R)-2-[(1R)-1-(2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-1-phenylethyl] acetate (PubChem CID 12031457) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [(1R)-2-[(1R)-1-(2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-1-phenylethyl] acetate.
| Compound Name | [(1R)-2-[(1R)-1-(2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 12031457 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [(1R)-2-[(1R)-1-(2-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxo-1-phenylethyl] acetate |
| SMILES | CC(=O)O[C@@H](C(=O)N1CCc2ccccc2[C@@H]1c1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C25H22N2O5/c1-17(28)32-24(19-10-3-2-4-11-19)25(29)26-16-15-18-9-5-6-12-20(18)23(26)21-13-7-8-14-22(21)27(30)31/h2-14,23-24H,15-16H2,1H3/t23-,24-/m1/s1 |
| InChIKey | JZWKQVVXNKXGAL-DNQXCXABSA-N |
| XLogP | 4.37 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|