C24H24N2O4 — CID 91228845
ethane;(4-nitrophenyl) 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 91228845) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethane;(4-nitrophenyl) 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | ethane;(4-nitrophenyl) 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 91228845 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethane;(4-nitrophenyl) 1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC.O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C22H18N2O4.C2H6/c25-22(28-19-12-10-18(11-13-19)24(26)27)23-15-14-16-6-4-5-9-20(16)21(23)17-7-2-1-3-8-17;1-2/h1-13,21H,14-15H2;1-2H3 |
| InChIKey | KMZZLPQWBWWGSH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|