C16H26O8S2 — CID 12031871
diethyl 2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)disulfanyl]butanedioate (PubChem CID 12031871) has the molecular formula C16H26O8S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is diethyl 2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)disulfanyl]butanedioate.
| Compound Name | diethyl 2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)disulfanyl]butanedioate |
|---|---|
| PubChem CID | 12031871 |
| Molecular Formula | C16H26O8S2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | diethyl 2-[(1,4-diethoxy-1,4-dioxobutan-2-yl)disulfanyl]butanedioate |
| SMILES | CCOC(=O)CC(SSC(CC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H26O8S2/c1-5-21-13(17)9-11(15(19)23-7-3)25-26-12(16(20)24-8-4)10-14(18)22-6-2/h11-12H,5-10H2,1-4H3 |
| InChIKey | WGYLQNYATPZUIZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|