C28H38O4S2 — CID 12031927
2-[6-[3,3-dimethyl-2-(4-methylphenyl)sulfinyloxiran-2-yl]hexyl]-3,3-dimethyl-2-(4-methylphenyl)sulfinyloxirane (PubChem CID 12031927) has the molecular formula C28H38O4S2 and a molecular weight of 502.74 g/mol. Its IUPAC name is 2-[6-[3,3-dimethyl-2-(4-methylphenyl)sulfinyloxiran-2-yl]hexyl]-3,3-dimethyl-2-(4-methylphenyl)sulfinyloxirane.
| Compound Name | 2-[6-[3,3-dimethyl-2-(4-methylphenyl)sulfinyloxiran-2-yl]hexyl]-3,3-dimethyl-2-(4-methylphenyl)sulfinyloxirane |
|---|---|
| PubChem CID | 12031927 |
| Molecular Formula | C28H38O4S2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[6-[3,3-dimethyl-2-(4-methylphenyl)sulfinyloxiran-2-yl]hexyl]-3,3-dimethyl-2-(4-methylphenyl)sulfinyloxirane |
| SMILES | Cc1ccc(S(=O)C2(CCCCCCC3(S(=O)c4ccc(C)cc4)OC3(C)C)OC2(C)C)cc1 |
| InChI | InChI=1S/C28H38O4S2/c1-21-11-15-23(16-12-21)33(29)27(25(3,4)31-27)19-9-7-8-10-20-28(26(5,6)32-28)34(30)24-17-13-22(2)14-18-24/h11-18H,7-10,19-20H2,1-6H3 |
| InChIKey | HLZTYMGAQCXXJD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|