About 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate
2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate (PubChem CID 143119381) has the molecular formula C13H18O4S
and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate.
Analyze 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate?
The IUPAC name of 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate (CID 143119381) is 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate.
What is the SMILES notation for 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate?
The canonical SMILES for 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate is Cc1ccc(S(=O)OCCC2(C)OCCO2)cc1.
What is the InChIKey of 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate?
The InChIKey is WREKBHDLXLHBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4S/c1-11-3-5-12(6-4-11)18(14)17-8-7-13(2)15-9-10-16-13/h3-6H,7-10H2,1-2H3.
What are the key properties of 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate?
2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate has a molecular weight of 270.35 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,3-dioxolan-2-yl)ethyl 4-methylbenzenesulfinate is sourced from PubChem (CID 143119381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).