About but-2-ynyl 4-methylbenzenesulfinate
but-2-ynyl 4-methylbenzenesulfinate (PubChem CID 131844431) has the molecular formula C11H12O2S
and a molecular weight of 208.28 g/mol. Its IUPAC name is but-2-ynyl 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | but-2-ynyl 4-methylbenzenesulfinate |
| PubChem CID | 131844431 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | but-2-ynyl 4-methylbenzenesulfinate |
| SMILES | CC#CCOS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H12O2S/c1-3-4-9-13-14(12)11-7-5-10(2)6-8-11/h5-8H,9H2,1-2H3 |
| InChIKey | VFGAOLUOTSEWNG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-ynyl 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ynyl 4-methylbenzenesulfinate?
The IUPAC name of but-2-ynyl 4-methylbenzenesulfinate (CID 131844431) is but-2-ynyl 4-methylbenzenesulfinate.
What is the SMILES notation for but-2-ynyl 4-methylbenzenesulfinate?
The canonical SMILES for but-2-ynyl 4-methylbenzenesulfinate is CC#CCOS(=O)c1ccc(C)cc1.
What is the InChIKey of but-2-ynyl 4-methylbenzenesulfinate?
The InChIKey is VFGAOLUOTSEWNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S/c1-3-4-9-13-14(12)11-7-5-10(2)6-8-11/h5-8H,9H2,1-2H3.
What are the key properties of but-2-ynyl 4-methylbenzenesulfinate?
but-2-ynyl 4-methylbenzenesulfinate has a molecular weight of 208.28 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ynyl 4-methylbenzenesulfinate is sourced from PubChem (CID 131844431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).