C32H39NO3SeSi — CID 12033109
(5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-3-[(2S)-1-phenylbut-3-en-2-yl]-2-(phenylselanylmethyl)-1,3-oxazolidin-4-one (PubChem CID 12033109) has the molecular formula C32H39NO3SeSi and a molecular weight of 592.71 g/mol. Its IUPAC name is (5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-3-[(2S)-1-phenylbut-3-en-2-yl]-2-(phenylselanylmethyl)-1,3-oxazolidin-4-one.
| Compound Name | (5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-3-[(2S)-1-phenylbut-3-en-2-yl]-2-(phenylselanylmethyl)-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 12033109 |
| Molecular Formula | C32H39NO3SeSi |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | (5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-3-[(2S)-1-phenylbut-3-en-2-yl]-2-(phenylselanylmethyl)-1,3-oxazolidin-4-one |
| SMILES | C=C[C@H](Cc1ccccc1)N1C(=O)[C@H](c2ccccc2)OC1(C[Se]c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H39NO3SeSi/c1-7-27(23-25-17-11-8-12-18-25)33-30(34)29(26-19-13-9-14-20-26)35-32(33,36-38(5,6)31(2,3)4)24-37-28-21-15-10-16-22-28/h7-22,27,29H,1,23-24H2,2-6H3/t27-,29+,32?/m1/s1 |
| InChIKey | VJGUQMPPLPXOTE-DJIBURDWSA-N |
| XLogP | 6.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|