C22H19NO2 — CID 639218
(2R,5R)-3-benzyl-2,5-diphenyl-1,3-oxazolidin-4-one (PubChem CID 639218) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R,5R)-3-benzyl-2,5-diphenyl-1,3-oxazolidin-4-one.
| Compound Name | (2R,5R)-3-benzyl-2,5-diphenyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 639218 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2R,5R)-3-benzyl-2,5-diphenyl-1,3-oxazolidin-4-one |
| SMILES | O=C1[C@@H](c2ccccc2)O[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c24-21-20(18-12-6-2-7-13-18)25-22(19-14-8-3-9-15-19)23(21)16-17-10-4-1-5-11-17/h1-15,20,22H,16H2/t20-,22-/m1/s1 |
| InChIKey | RZYOYTLIQKILHM-IFMALSPDSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |