C15H9N3O2 — CID 12034266
4-(9H-fluoren-2-yl)-1,2,4-triazole-3,5-dione (PubChem CID 12034266) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-(9H-fluoren-2-yl)-1,2,4-triazole-3,5-dione.
| Compound Name | 4-(9H-fluoren-2-yl)-1,2,4-triazole-3,5-dione |
|---|---|
| PubChem CID | 12034266 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(9H-fluoren-2-yl)-1,2,4-triazole-3,5-dione |
| SMILES | O=C1N=NC(=O)N1c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H9N3O2/c19-14-16-17-15(20)18(14)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | DAKKSUHBPVDMDB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |