C10H16Cl2O3 — CID 12034295
methyl (3S)-2,2-dichloro-3-cyclohexyl-3-hydroxypropanoate (PubChem CID 12034295) has the molecular formula C10H16Cl2O3 and a molecular weight of 255.14 g/mol. Its IUPAC name is methyl (3S)-2,2-dichloro-3-cyclohexyl-3-hydroxypropanoate.
| Compound Name | methyl (3S)-2,2-dichloro-3-cyclohexyl-3-hydroxypropanoate |
|---|---|
| PubChem CID | 12034295 |
| Molecular Formula | C10H16Cl2O3 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | methyl (3S)-2,2-dichloro-3-cyclohexyl-3-hydroxypropanoate |
| SMILES | COC(=O)C(Cl)(Cl)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C10H16Cl2O3/c1-15-9(14)10(11,12)8(13)7-5-3-2-4-6-7/h7-8,13H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | KLFFFCCUXUFTAB-QMMMGPOBSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|