C19H31NO2 — CID 1203452
N,3,5-tritert-butyl-4-hydroxybenzamide (PubChem CID 1203452) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is N,3,5-tritert-butyl-4-hydroxybenzamide.
| Compound Name | N,3,5-tritert-butyl-4-hydroxybenzamide |
|---|---|
| PubChem CID | 1203452 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N,3,5-tritert-butyl-4-hydroxybenzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO2/c1-17(2,3)13-10-12(16(22)20-19(7,8)9)11-14(15(13)21)18(4,5)6/h10-11,21H,1-9H3,(H,20,22) |
| InChIKey | WPSAIYCESWUJIG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |