C19H31NO2 — CID 830652
3,5-ditert-butyl-N,N-diethyl-4-hydroxybenzamide (PubChem CID 830652) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3,5-ditert-butyl-N,N-diethyl-4-hydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N,N-diethyl-4-hydroxybenzamide |
|---|---|
| PubChem CID | 830652 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 3,5-ditert-butyl-N,N-diethyl-4-hydroxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO2/c1-9-20(10-2)17(22)13-11-14(18(3,4)5)16(21)15(12-13)19(6,7)8/h11-12,21H,9-10H2,1-8H3 |
| InChIKey | CRGGZROSUFGGFE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |